C13H15Cl2NO2 — CID 54918547
ethyl 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetate (PubChem CID 54918547) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is ethyl 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetate.
| Compound Name | ethyl 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 54918547 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | ethyl 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetate |
| SMILES | CCOC(=O)C(NC1CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO2/c1-2-18-13(17)12(16-9-4-5-9)10-6-3-8(14)7-11(10)15/h3,6-7,9,12,16H,2,4-5H2,1H3 |
| InChIKey | VKHYERDQUVKMGA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |