C15H19Cl2NO2 — CID 60998051
ethyl 2-(cyclopentylamino)-2-(3,5-dichlorophenyl)acetate (PubChem CID 60998051) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is ethyl 2-(cyclopentylamino)-2-(3,5-dichlorophenyl)acetate.
| Compound Name | ethyl 2-(cyclopentylamino)-2-(3,5-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 60998051 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | ethyl 2-(cyclopentylamino)-2-(3,5-dichlorophenyl)acetate |
| SMILES | CCOC(=O)C(NC1CCCC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-2-20-15(19)14(18-13-5-3-4-6-13)10-7-11(16)9-12(17)8-10/h7-9,13-14,18H,2-6H2,1H3 |
| InChIKey | FOLSOXIXGPBYRM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |