2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid

C14H17Cl2NO2 — CID 54893022

IUPAC2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid
SMILESO=C(O)C(NC1CCCCC1)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C14H17Cl2NO2/c15-10-6-9(7-11(16)8-10)13(14(18)19)17-12-4-2-1-3-5-12/h6-8,12-13,17H,1-5H2,(H,18,19)
InChIKeyAYHNTJSURDFZSP-UHFFFAOYSA-N
MW302.20 g/mol
LogP4.04
Rot. Bonds4

About 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid

2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid (PubChem CID 54893022) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid.

Molecular Properties

Compound Name2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid
PubChem CID54893022
Molecular FormulaC14H17Cl2NO2
Molecular Weight302.20 g/mol
Exact Mass301.06
IUPAC Name2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid
SMILESO=C(O)C(NC1CCCCC1)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C14H17Cl2NO2/c15-10-6-9(7-11(16)8-10)13(14(18)19)17-12-4-2-1-3-5-12/h6-8,12-13,17H,1-5H2,(H,18,19)
InChIKeyAYHNTJSURDFZSP-UHFFFAOYSA-N
XLogP4.04
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.20
LogP ≤ 54.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid?
The IUPAC name of 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid (CID 54893022) is 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid.
What is the SMILES notation for 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid?
The canonical SMILES for 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid is O=C(O)C(NC1CCCCC1)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid?
The InChIKey is AYHNTJSURDFZSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO2/c15-10-6-9(7-11(16)8-10)13(14(18)19)17-12-4-2-1-3-5-12/h6-8,12-13,17H,1-5H2,(H,18,19).
What are the key properties of 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid?
2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid has a molecular weight of 302.20 g/mol, XLogP of 4.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylamino)-2-(3,5-dichlorophenyl)acetic acid is sourced from PubChem (CID 54893022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).