C17H25NO2 — CID 60997589
2-(cyclohexylamino)-2-(2,4,6-trimethylphenyl)acetic acid (PubChem CID 60997589) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-(cyclohexylamino)-2-(2,4,6-trimethylphenyl)acetic acid.
| Compound Name | 2-(cyclohexylamino)-2-(2,4,6-trimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 60997589 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-(cyclohexylamino)-2-(2,4,6-trimethylphenyl)acetic acid |
| SMILES | Cc1cc(C)c(C(NC2CCCCC2)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H25NO2/c1-11-9-12(2)15(13(3)10-11)16(17(19)20)18-14-7-5-4-6-8-14/h9-10,14,16,18H,4-8H2,1-3H3,(H,19,20) |
| InChIKey | ZYFPCFIITKVNDZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |