About 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid
2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid (PubChem CID 63704772) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid.
Molecular Properties
| Compound Name | 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid |
| PubChem CID | 63704772 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid |
| SMILES | CC(=O)NC(C(=O)O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H17NO3/c1-7-5-8(2)11(9(3)6-7)12(13(16)17)14-10(4)15/h5-6,12H,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | OGWPGCLNBWGOHX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid?
The IUPAC name of 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid (CID 63704772) is 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid.
What is the SMILES notation for 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid?
The canonical SMILES for 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid is CC(=O)NC(C(=O)O)c1c(C)cc(C)cc1C.
What is the InChIKey of 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid?
The InChIKey is OGWPGCLNBWGOHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-7-5-8(2)11(9(3)6-7)12(13(16)17)14-10(4)15/h5-6,12H,1-4H3,(H,14,15)(H,16,17).
What are the key properties of 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid?
2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid has a molecular weight of 235.28 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-2-(2,4,6-trimethylphenyl)acetic acid is sourced from PubChem (CID 63704772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).