2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid

C13H14F3NO2 — CID 55148711

IUPAC2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid
SMILESO=C(O)C(NC1CCCC1)c1cc(F)c(F)c(F)c1
InChIInChI=1S/C13H14F3NO2/c14-9-5-7(6-10(15)11(9)16)12(13(18)19)17-8-3-1-2-4-8/h5-6,8,12,17H,1-4H2,(H,18,19)
InChIKeyFVYVRDLQFFUNBK-UHFFFAOYSA-N
MW273.25 g/mol
LogP2.76
Rot. Bonds4

About 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid

2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid (PubChem CID 55148711) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid.

Molecular Properties

Compound Name2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid
PubChem CID55148711
Molecular FormulaC13H14F3NO2
Molecular Weight273.25 g/mol
Exact Mass273.10
IUPAC Name2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid
SMILESO=C(O)C(NC1CCCC1)c1cc(F)c(F)c(F)c1
InChIInChI=1S/C13H14F3NO2/c14-9-5-7(6-10(15)11(9)16)12(13(18)19)17-8-3-1-2-4-8/h5-6,8,12,17H,1-4H2,(H,18,19)
InChIKeyFVYVRDLQFFUNBK-UHFFFAOYSA-N
XLogP2.76
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.25
LogP ≤ 52.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid?
The IUPAC name of 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid (CID 55148711) is 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid.
What is the SMILES notation for 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid?
The canonical SMILES for 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid is O=C(O)C(NC1CCCC1)c1cc(F)c(F)c(F)c1.
What is the InChIKey of 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid?
The InChIKey is FVYVRDLQFFUNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3NO2/c14-9-5-7(6-10(15)11(9)16)12(13(18)19)17-8-3-1-2-4-8/h5-6,8,12,17H,1-4H2,(H,18,19).
What are the key properties of 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid?
2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid has a molecular weight of 273.25 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid is sourced from PubChem (CID 55148711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).