C13H14F3NO2 — CID 55148711
2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid (PubChem CID 55148711) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid.
| Compound Name | 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid |
|---|---|
| PubChem CID | 55148711 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-(cyclopentylamino)-2-(3,4,5-trifluorophenyl)acetic acid |
| SMILES | O=C(O)C(NC1CCCC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H14F3NO2/c14-9-5-7(6-10(15)11(9)16)12(13(18)19)17-8-3-1-2-4-8/h5-6,8,12,17H,1-4H2,(H,18,19) |
| InChIKey | FVYVRDLQFFUNBK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|