C14H17F2NO3 — CID 84746728
2-(3,4-difluorophenyl)-2-[(4-hydroxycyclohexyl)amino]acetic acid (PubChem CID 84746728) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-[(4-hydroxycyclohexyl)amino]acetic acid.
| Compound Name | 2-(3,4-difluorophenyl)-2-[(4-hydroxycyclohexyl)amino]acetic acid |
|---|---|
| PubChem CID | 84746728 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-[(4-hydroxycyclohexyl)amino]acetic acid |
| SMILES | O=C(O)C(NC1CCC(O)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H17F2NO3/c15-11-6-1-8(7-12(11)16)13(14(19)20)17-9-2-4-10(18)5-3-9/h1,6-7,9-10,13,17-18H,2-5H2,(H,19,20) |
| InChIKey | FSAMTRUUTYPHSD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |