C10H9F2NO4 — CID 84746691
2-(carboxymethylamino)-2-(3,4-difluorophenyl)acetic acid (PubChem CID 84746691) has the molecular formula C10H9F2NO4 and a molecular weight of 245.18 g/mol. Its IUPAC name is 2-(carboxymethylamino)-2-(3,4-difluorophenyl)acetic acid.
| Compound Name | 2-(carboxymethylamino)-2-(3,4-difluorophenyl)acetic acid |
|---|---|
| PubChem CID | 84746691 |
| Molecular Formula | C10H9F2NO4 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(carboxymethylamino)-2-(3,4-difluorophenyl)acetic acid |
| SMILES | O=C(O)CNC(C(=O)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H9F2NO4/c11-6-2-1-5(3-7(6)12)9(10(16)17)13-4-8(14)15/h1-3,9,13H,4H2,(H,14,15)(H,16,17) |
| InChIKey | RGTPDSXEFRKKRF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |