C14H8F4O2 — CID 20677452
2,2-bis(3,4-difluorophenyl)acetic acid (PubChem CID 20677452) has the molecular formula C14H8F4O2 and a molecular weight of 284.21 g/mol. Its IUPAC name is 2,2-bis(3,4-difluorophenyl)acetic acid.
| Compound Name | 2,2-bis(3,4-difluorophenyl)acetic acid |
|---|---|
| PubChem CID | 20677452 |
| Molecular Formula | C14H8F4O2 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2,2-bis(3,4-difluorophenyl)acetic acid |
| SMILES | O=C(O)C(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H8F4O2/c15-9-3-1-7(5-11(9)17)13(14(19)20)8-2-4-10(16)12(18)6-8/h1-6,13H,(H,19,20) |
| InChIKey | GMAATIXFAPDFDU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |