2,2-bis(3,4-difluorophenyl)acetic acid

C14H8F4O2 — CID 20677452

IUPAC2,2-bis(3,4-difluorophenyl)acetic acid
SMILESO=C(O)C(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1
InChIInChI=1S/C14H8F4O2/c15-9-3-1-7(5-11(9)17)13(14(19)20)8-2-4-10(16)12(18)6-8/h1-6,13H,(H,19,20)
InChIKeyGMAATIXFAPDFDU-UHFFFAOYSA-N
MW284.21 g/mol
LogP3.46
Rot. Bonds3

About 2,2-bis(3,4-difluorophenyl)acetic acid

2,2-bis(3,4-difluorophenyl)acetic acid (PubChem CID 20677452) has the molecular formula C14H8F4O2 and a molecular weight of 284.21 g/mol. Its IUPAC name is 2,2-bis(3,4-difluorophenyl)acetic acid.

Molecular Properties

Compound Name2,2-bis(3,4-difluorophenyl)acetic acid
PubChem CID20677452
Molecular FormulaC14H8F4O2
Molecular Weight284.21 g/mol
Exact Mass284.05
IUPAC Name2,2-bis(3,4-difluorophenyl)acetic acid
SMILESO=C(O)C(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1
InChIInChI=1S/C14H8F4O2/c15-9-3-1-7(5-11(9)17)13(14(19)20)8-2-4-10(16)12(18)6-8/h1-6,13H,(H,19,20)
InChIKeyGMAATIXFAPDFDU-UHFFFAOYSA-N
XLogP3.46
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.21
LogP ≤ 53.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,2-bis(3,4-difluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(3,4-difluorophenyl)acetic acid?
The IUPAC name of 2,2-bis(3,4-difluorophenyl)acetic acid (CID 20677452) is 2,2-bis(3,4-difluorophenyl)acetic acid.
What is the SMILES notation for 2,2-bis(3,4-difluorophenyl)acetic acid?
The canonical SMILES for 2,2-bis(3,4-difluorophenyl)acetic acid is O=C(O)C(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1.
What is the InChIKey of 2,2-bis(3,4-difluorophenyl)acetic acid?
The InChIKey is GMAATIXFAPDFDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F4O2/c15-9-3-1-7(5-11(9)17)13(14(19)20)8-2-4-10(16)12(18)6-8/h1-6,13H,(H,19,20).
What are the key properties of 2,2-bis(3,4-difluorophenyl)acetic acid?
2,2-bis(3,4-difluorophenyl)acetic acid has a molecular weight of 284.21 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(3,4-difluorophenyl)acetic acid is sourced from PubChem (CID 20677452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).