C8H4ClF3O — CID 174899549
2-(3,4-difluorophenyl)-2-fluoroacetyl chloride (PubChem CID 174899549) has the molecular formula C8H4ClF3O and a molecular weight of 208.57 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-fluoroacetyl chloride.
| Compound Name | 2-(3,4-difluorophenyl)-2-fluoroacetyl chloride |
|---|---|
| PubChem CID | 174899549 |
| Molecular Formula | C8H4ClF3O |
| Molecular Weight | 208.57 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-fluoroacetyl chloride |
| SMILES | O=C(Cl)C(F)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H4ClF3O/c9-8(13)7(12)4-1-2-5(10)6(11)3-4/h1-3,7H |
| InChIKey | AZLRHVUGGFWTJI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|