C8H8F5N — CID 175581175
azane;1,2-difluoro-4-(1,2,2-trifluoroethyl)benzene (PubChem CID 175581175) has the molecular formula C8H8F5N and a molecular weight of 213.15 g/mol. Its IUPAC name is azane;1,2-difluoro-4-(1,2,2-trifluoroethyl)benzene.
| Compound Name | azane;1,2-difluoro-4-(1,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 175581175 |
| Molecular Formula | C8H8F5N |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | azane;1,2-difluoro-4-(1,2,2-trifluoroethyl)benzene |
| SMILES | Fc1ccc(C(F)C(F)F)cc1F.N |
| InChI | InChI=1S/C8H5F5.H3N/c9-5-2-1-4(3-6(5)10)7(11)8(12)13;/h1-3,7-8H;1H3 |
| InChIKey | LSTNVMCWMXRRTH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |