C8H5BrF4 — CID 166687880
1-bromo-2-fluoro-4-(1,2,2-trifluoroethyl)benzene (PubChem CID 166687880) has the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. Its IUPAC name is 1-bromo-2-fluoro-4-(1,2,2-trifluoroethyl)benzene.
| Compound Name | 1-bromo-2-fluoro-4-(1,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 166687880 |
| Molecular Formula | C8H5BrF4 |
| Molecular Weight | 257.02 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 1-bromo-2-fluoro-4-(1,2,2-trifluoroethyl)benzene |
| SMILES | Fc1cc(C(F)C(F)F)ccc1Br |
| InChI | InChI=1S/C8H5BrF4/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7-8H |
| InChIKey | YNRGIYPGUMHURC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.02 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |