C15H10Br3FO2 — CID 63441639
6-bromo-7-[bromo-(4-bromo-3-fluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 63441639) has the molecular formula C15H10Br3FO2 and a molecular weight of 480.95 g/mol. Its IUPAC name is 6-bromo-7-[bromo-(4-bromo-3-fluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-bromo-7-[bromo-(4-bromo-3-fluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 63441639 |
| Molecular Formula | C15H10Br3FO2 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 477.82 |
| IUPAC Name | 6-bromo-7-[bromo-(4-bromo-3-fluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Fc1cc(C(Br)c2cc3c(cc2Br)OCCO3)ccc1Br |
| InChI | InChI=1S/C15H10Br3FO2/c16-10-2-1-8(5-12(10)19)15(18)9-6-13-14(7-11(9)17)21-4-3-20-13/h1-2,5-7,15H,3-4H2 |
| InChIKey | IORYKUWIMYYLCX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|