C15H11BrF2O2 — CID 61096293
6-[bromo-(3,4-difluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 61096293) has the molecular formula C15H11BrF2O2 and a molecular weight of 341.15 g/mol. Its IUPAC name is 6-[bromo-(3,4-difluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[bromo-(3,4-difluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 61096293 |
| Molecular Formula | C15H11BrF2O2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 6-[bromo-(3,4-difluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Fc1ccc(C(Br)c2ccc3c(c2)OCCO3)cc1F |
| InChI | InChI=1S/C15H11BrF2O2/c16-15(9-1-3-11(17)12(18)7-9)10-2-4-13-14(8-10)20-6-5-19-13/h1-4,7-8,15H,5-6H2 |
| InChIKey | HEJIIDUQVZAZOC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|