C13H8Br2F2 — CID 55199317
4-[bromo-(4-bromophenyl)methyl]-1,2-difluorobenzene (PubChem CID 55199317) has the molecular formula C13H8Br2F2 and a molecular weight of 362.01 g/mol. Its IUPAC name is 4-[bromo-(4-bromophenyl)methyl]-1,2-difluorobenzene.
| Compound Name | 4-[bromo-(4-bromophenyl)methyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 55199317 |
| Molecular Formula | C13H8Br2F2 |
| Molecular Weight | 362.01 g/mol |
| Exact Mass | 359.90 |
| IUPAC Name | 4-[bromo-(4-bromophenyl)methyl]-1,2-difluorobenzene |
| SMILES | Fc1ccc(C(Br)c2ccc(Br)cc2)cc1F |
| InChI | InChI=1S/C13H8Br2F2/c14-10-4-1-8(2-5-10)13(15)9-3-6-11(16)12(17)7-9/h1-7,13H |
| InChIKey | JCHALEVFVPILGA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.01 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|