About 4-bromo-1,2-difluorobenzene;dihydrofluoride
4-bromo-1,2-difluorobenzene;dihydrofluoride (PubChem CID 174492303) has the molecular formula C6H5BrF4
and a molecular weight of 233.00 g/mol. Its IUPAC name is 4-bromo-1,2-difluorobenzene;dihydrofluoride.
Molecular Properties
| Compound Name | 4-bromo-1,2-difluorobenzene;dihydrofluoride |
| PubChem CID | 174492303 |
| Molecular Formula | C6H5BrF4 |
| Molecular Weight | 233.00 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 4-bromo-1,2-difluorobenzene;dihydrofluoride |
| SMILES | F.F.Fc1ccc(Br)cc1F |
| InChI | InChI=1S/C6H3BrF2.2FH/c7-4-1-2-5(8)6(9)3-4;;/h1-3H;2*1H |
| InChIKey | VHSFUDYVIOUPRI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.00 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,2-difluorobenzene;dihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,2-difluorobenzene;dihydrofluoride?
The IUPAC name of 4-bromo-1,2-difluorobenzene;dihydrofluoride (CID 174492303) is 4-bromo-1,2-difluorobenzene;dihydrofluoride.
What is the SMILES notation for 4-bromo-1,2-difluorobenzene;dihydrofluoride?
The canonical SMILES for 4-bromo-1,2-difluorobenzene;dihydrofluoride is F.F.Fc1ccc(Br)cc1F.
What is the InChIKey of 4-bromo-1,2-difluorobenzene;dihydrofluoride?
The InChIKey is VHSFUDYVIOUPRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrF2.2FH/c7-4-1-2-5(8)6(9)3-4;;/h1-3H;2*1H.
What are the key properties of 4-bromo-1,2-difluorobenzene;dihydrofluoride?
4-bromo-1,2-difluorobenzene;dihydrofluoride has a molecular weight of 233.00 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,2-difluorobenzene;dihydrofluoride is sourced from PubChem (CID 174492303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).