C13H8BrF2NO — CID 116591705
(2-amino-4-bromophenyl)-(3,4-difluorophenyl)methanone (PubChem CID 116591705) has the molecular formula C13H8BrF2NO and a molecular weight of 312.11 g/mol. Its IUPAC name is (2-amino-4-bromophenyl)-(3,4-difluorophenyl)methanone.
| Compound Name | (2-amino-4-bromophenyl)-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 116591705 |
| Molecular Formula | C13H8BrF2NO |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | (2-amino-4-bromophenyl)-(3,4-difluorophenyl)methanone |
| SMILES | Nc1cc(Br)ccc1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H8BrF2NO/c14-8-2-3-9(12(17)6-8)13(18)7-1-4-10(15)11(16)5-7/h1-6H,17H2 |
| InChIKey | NDPNYQDNYXDVLY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|