C11H5F2NO3 — CID 142659174
3-amino-4-(3,4-difluorobenzoyl)cyclobut-3-ene-1,2-dione (PubChem CID 142659174) has the molecular formula C11H5F2NO3 and a molecular weight of 237.16 g/mol. Its IUPAC name is 3-amino-4-(3,4-difluorobenzoyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-(3,4-difluorobenzoyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142659174 |
| Molecular Formula | C11H5F2NO3 |
| Molecular Weight | 237.16 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 3-amino-4-(3,4-difluorobenzoyl)cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(C(=O)c2ccc(F)c(F)c2)c(=O)c1=O |
| InChI | InChI=1S/C11H5F2NO3/c12-5-2-1-4(3-6(5)13)9(15)7-8(14)11(17)10(7)16/h1-3H,14H2 |
| InChIKey | FJFIKUBRODSRFI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|