C13H7F2IO — CID 24723141
(3,4-difluorophenyl)-(4-iodophenyl)methanone (PubChem CID 24723141) has the molecular formula C13H7F2IO and a molecular weight of 344.10 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(4-iodophenyl)methanone.
| Compound Name | (3,4-difluorophenyl)-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 24723141 |
| Molecular Formula | C13H7F2IO |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | (3,4-difluorophenyl)-(4-iodophenyl)methanone |
| SMILES | O=C(c1ccc(I)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H7F2IO/c14-11-6-3-9(7-12(11)15)13(17)8-1-4-10(16)5-2-8/h1-7H |
| InChIKey | MOACLHVWLJRANL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|