C13H8F2O3 — CID 117000378
(3,4-difluorophenyl)-(3,4-dihydroxyphenyl)methanone (PubChem CID 117000378) has the molecular formula C13H8F2O3 and a molecular weight of 250.20 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(3,4-dihydroxyphenyl)methanone.
| Compound Name | (3,4-difluorophenyl)-(3,4-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 117000378 |
| Molecular Formula | C13H8F2O3 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | (3,4-difluorophenyl)-(3,4-dihydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)c(O)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H8F2O3/c14-9-3-1-7(5-10(9)15)13(18)8-2-4-11(16)12(17)6-8/h1-6,16-17H |
| InChIKey | JFQWQOPBMBQLRW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|