C13H9BrO3 — CID 23509276
(4-bromophenyl)-(3,4-dihydroxyphenyl)methanone (PubChem CID 23509276) has the molecular formula C13H9BrO3 and a molecular weight of 293.12 g/mol. Its IUPAC name is (4-bromophenyl)-(3,4-dihydroxyphenyl)methanone.
| Compound Name | (4-bromophenyl)-(3,4-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 23509276 |
| Molecular Formula | C13H9BrO3 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | (4-bromophenyl)-(3,4-dihydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(Br)cc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H9BrO3/c14-10-4-1-8(2-5-10)13(17)9-3-6-11(15)12(16)7-9/h1-7,15-16H |
| InChIKey | YBNJBVQDDPDCPO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|