C7H10Cl3O3P — CID 70442762
(3,4-dihydroxyphenyl)-phosphanylmethanone;trihydrochloride (PubChem CID 70442762) has the molecular formula C7H10Cl3O3P and a molecular weight of 279.49 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-phosphanylmethanone;trihydrochloride.
| Compound Name | (3,4-dihydroxyphenyl)-phosphanylmethanone;trihydrochloride |
|---|---|
| PubChem CID | 70442762 |
| Molecular Formula | C7H10Cl3O3P |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | (3,4-dihydroxyphenyl)-phosphanylmethanone;trihydrochloride |
| SMILES | Cl.Cl.Cl.O=C(P)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C7H7O3P.3ClH/c8-5-2-1-4(7(10)11)3-6(5)9;;;/h1-3,8-9H,11H2;3*1H |
| InChIKey | KXXZOGDBIMMLBY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|