About dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone
dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone (PubChem CID 88842379) has the molecular formula C7H5Cl2O3P
and a molecular weight of 238.99 g/mol. Its IUPAC name is dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone.
Molecular Properties
| Compound Name | dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone |
| PubChem CID | 88842379 |
| Molecular Formula | C7H5Cl2O3P |
| Molecular Weight | 238.99 g/mol |
| Exact Mass | 237.94 |
| IUPAC Name | dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)c(O)c1)P(Cl)Cl |
| InChI | InChI=1S/C7H5Cl2O3P/c8-13(9)7(12)4-1-2-5(10)6(11)3-4/h1-3,10-11H |
| InChIKey | UBGRBFGYKFWCJE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.99 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone?
The IUPAC name of dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone (CID 88842379) is dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone.
What is the SMILES notation for dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone?
The canonical SMILES for dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone is O=C(c1ccc(O)c(O)c1)P(Cl)Cl.
What is the InChIKey of dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone?
The InChIKey is UBGRBFGYKFWCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2O3P/c8-13(9)7(12)4-1-2-5(10)6(11)3-4/h1-3,10-11H.
What are the key properties of dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone?
dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone has a molecular weight of 238.99 g/mol, XLogP of 3.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone is sourced from PubChem (CID 88842379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).