C7H5Cl2O3P — CID 88842379
dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone (PubChem CID 88842379) has the molecular formula C7H5Cl2O3P and a molecular weight of 238.99 g/mol. Its IUPAC name is dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone.
| Compound Name | dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 88842379 |
| Molecular Formula | C7H5Cl2O3P |
| Molecular Weight | 238.99 g/mol |
| Exact Mass | 237.94 |
| IUPAC Name | dichlorophosphanyl-(3,4-dihydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)c(O)c1)P(Cl)Cl |
| InChI | InChI=1S/C7H5Cl2O3P/c8-13(9)7(12)4-1-2-5(10)6(11)3-4/h1-3,10-11H |
| InChIKey | UBGRBFGYKFWCJE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.99 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|