C8H10NO3+ — CID 168916285
[2-(3,4-dihydroxyphenyl)-2-oxoethyl]azanium (PubChem CID 168916285) has the molecular formula C8H10NO3+ and a molecular weight of 168.17 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-2-oxoethyl]azanium.
| Compound Name | [2-(3,4-dihydroxyphenyl)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 168916285 |
| Molecular Formula | C8H10NO3+ |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-2-oxoethyl]azanium |
| SMILES | [NH3+]CC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H9NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,10-11H,4,9H2/p+1 |
| InChIKey | CNFQARFTXUBHJY-UHFFFAOYSA-O |
| XLogP | -0.48 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|