C17H18ClNO6 — CID 175674657
1-(3,4-dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-2-oxoethyl]-methylamino]ethanone;hydrochloride (PubChem CID 175674657) has the molecular formula C17H18ClNO6 and a molecular weight of 367.79 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-2-oxoethyl]-methylamino]ethanone;hydrochloride.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-2-oxoethyl]-methylamino]ethanone;hydrochloride |
|---|---|
| PubChem CID | 175674657 |
| Molecular Formula | C17H18ClNO6 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-2-oxoethyl]-methylamino]ethanone;hydrochloride |
| SMILES | CN(CC(=O)c1ccc(O)c(O)c1)CC(=O)c1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C17H17NO6.ClH/c1-18(8-16(23)10-2-4-12(19)14(21)6-10)9-17(24)11-3-5-13(20)15(22)7-11;/h2-7,19-22H,8-9H2,1H3;1H |
| InChIKey | HVPQYTNWXGGKRH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|