C8H8O3S — CID 168916291
1-(3,4-dihydroxyphenyl)-2-sulfanylethanone (PubChem CID 168916291) has the molecular formula C8H8O3S and a molecular weight of 184.22 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-sulfanylethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-sulfanylethanone |
|---|---|
| PubChem CID | 168916291 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-sulfanylethanone |
| SMILES | O=C(CS)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H8O3S/c9-6-2-1-5(3-7(6)10)8(11)4-12/h1-3,9-10,12H,4H2 |
| InChIKey | RHZJULPUBUPCSS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|