C17H28NO3+ — CID 176583046
[2-(3,4-dihydroxyphenyl)-2-oxoethyl]-tri(propan-2-yl)azanium (PubChem CID 176583046) has the molecular formula C17H28NO3+ and a molecular weight of 294.42 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-2-oxoethyl]-tri(propan-2-yl)azanium.
| Compound Name | [2-(3,4-dihydroxyphenyl)-2-oxoethyl]-tri(propan-2-yl)azanium |
|---|---|
| PubChem CID | 176583046 |
| Molecular Formula | C17H28NO3+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-2-oxoethyl]-tri(propan-2-yl)azanium |
| SMILES | CC(C)[N+](CC(=O)c1ccc(O)c(O)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H27NO3/c1-11(2)18(12(3)4,13(5)6)10-17(21)14-7-8-15(19)16(20)9-14/h7-9,11-13H,10H2,1-6H3,(H-,19,20,21)/p+1 |
| InChIKey | XXHSLQJCMBEKCQ-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|