C11H16INO3 — CID 171375929
2-hydroxy-4-[2-(trimethylazaniumyl)acetyl]phenolate;hydroiodide (PubChem CID 171375929) has the molecular formula C11H16INO3 and a molecular weight of 337.16 g/mol. Its IUPAC name is 2-hydroxy-4-[2-(trimethylazaniumyl)acetyl]phenolate;hydroiodide.
| Compound Name | 2-hydroxy-4-[2-(trimethylazaniumyl)acetyl]phenolate;hydroiodide |
|---|---|
| PubChem CID | 171375929 |
| Molecular Formula | C11H16INO3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-hydroxy-4-[2-(trimethylazaniumyl)acetyl]phenolate;hydroiodide |
| SMILES | C[N+](C)(C)CC(=O)c1ccc([O-])c(O)c1.I |
| InChI | InChI=1S/C11H15NO3.HI/c1-12(2,3)7-11(15)8-4-5-9(13)10(14)6-8;/h4-6H,7H2,1-3H3,(H-,13,14,15);1H |
| InChIKey | RZFDCVOWEDIVKQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|