C21H15ClN4O3S — CID 4566697
4-[2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]-2-hydroxyphenolate (PubChem CID 4566697) has the molecular formula C21H15ClN4O3S and a molecular weight of 438.90 g/mol. Its IUPAC name is 4-[2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]-2-hydroxyphenolate.
| Compound Name | 4-[2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]-2-hydroxyphenolate |
|---|---|
| PubChem CID | 4566697 |
| Molecular Formula | C21H15ClN4O3S |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 4-[2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]acetyl]-2-hydroxyphenolate |
| SMILES | O=C(CSc1n[nH]c(-c2ccncc2)[n+]1-c1ccc(Cl)cc1)c1ccc([O-])c(O)c1 |
| InChI | InChI=1S/C21H15ClN4O3S/c22-15-2-4-16(5-3-15)26-20(13-7-9-23-10-8-13)24-25-21(26)30-12-19(29)14-1-6-17(27)18(28)11-14/h1-11H,12H2,(H2,23,24,27,28,29) |
| InChIKey | GYOZYDWOHLTBHR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|