C20H31NO6S2 — CID 161079800
4-carboxy-2-hydroxyphenolate;2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium (PubChem CID 161079800) has the molecular formula C20H31NO6S2 and a molecular weight of 445.60 g/mol. Its IUPAC name is 4-carboxy-2-hydroxyphenolate;2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium.
| Compound Name | 4-carboxy-2-hydroxyphenolate;2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 161079800 |
| Molecular Formula | C20H31NO6S2 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 4-carboxy-2-hydroxyphenolate;2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOC(=O)CCCC[C@@H]1CCSS1.O=C(O)c1ccc([O-])c(O)c1 |
| InChI | InChI=1S/C13H26NO2S2.C7H6O4/c1-14(2,3)9-10-16-13(15)7-5-4-6-12-8-11-17-18-12;8-5-2-1-4(7(10)11)3-6(5)9/h12H,4-11H2,1-3H3;1-3,8-9H,(H,10,11)/q+1;/p-1/t12-;/m1./s1 |
| InChIKey | UFTMPXNDHAQDRM-UTONKHPSSA-M |
| XLogP | 3.11 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|