C21H29ClO5S2 — CID 162665736
3-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxypropyl 5-(dithiolan-3-yl)pentanoate (PubChem CID 162665736) has the molecular formula C21H29ClO5S2 and a molecular weight of 461.05 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxypropyl 5-(dithiolan-3-yl)pentanoate.
| Compound Name | 3-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxypropyl 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 162665736 |
| Molecular Formula | C21H29ClO5S2 |
| Molecular Weight | 461.05 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxypropyl 5-(dithiolan-3-yl)pentanoate |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCCOC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C21H29ClO5S2/c1-21(2,27-17-10-8-16(22)9-11-17)20(24)26-14-5-13-25-19(23)7-4-3-6-18-12-15-28-29-18/h8-11,18H,3-7,12-15H2,1-2H3 |
| InChIKey | OLSBTGGHTDNWCL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.05 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|