About 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane
2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane (PubChem CID 178087575) has the molecular formula C13H24O4S2
and a molecular weight of 308.46 g/mol. Its IUPAC name is 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane.
Molecular Properties
| Compound Name | 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane |
| PubChem CID | 178087575 |
| Molecular Formula | C13H24O4S2 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane |
| SMILES | CC.CC(=O)OCCOC(=O)CCCC1CCSS1 |
| InChI | InChI=1S/C11H18O4S2.C2H6/c1-9(12)14-6-7-15-11(13)4-2-3-10-5-8-16-17-10;1-2/h10H,2-8H2,1H3;1-2H3 |
| InChIKey | GKJFWRPDKWAHOW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane?
The IUPAC name of 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane (CID 178087575) is 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane.
What is the SMILES notation for 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane?
The canonical SMILES for 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane is CC.CC(=O)OCCOC(=O)CCCC1CCSS1.
What is the InChIKey of 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane?
The InChIKey is GKJFWRPDKWAHOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4S2.C2H6/c1-9(12)14-6-7-15-11(13)4-2-3-10-5-8-16-17-10;1-2/h10H,2-8H2,1H3;1-2H3.
What are the key properties of 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane?
2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane has a molecular weight of 308.46 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl 4-(dithiolan-3-yl)butanoate;ethane is sourced from PubChem (CID 178087575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).