C13H24O5S2 — CID 102517907
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] 5-(dithiolan-3-yl)pentanoate (PubChem CID 102517907) has the molecular formula C13H24O5S2 and a molecular weight of 324.46 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 5-(dithiolan-3-yl)pentanoate.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 102517907 |
| Molecular Formula | C13H24O5S2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 5-(dithiolan-3-yl)pentanoate |
| SMILES | O=C(CCCCC1CCSS1)OCC(CO)(CO)CO |
| InChI | InChI=1S/C13H24O5S2/c14-7-13(8-15,9-16)10-18-12(17)4-2-1-3-11-5-6-19-20-11/h11,14-16H,1-10H2 |
| InChIKey | SKRMHQQKUYVBDK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|