C8H15ClO2S2 — CID 87930761
5-(dithiolan-3-yl)pentanoic acid;hydrochloride (PubChem CID 87930761) has the molecular formula C8H15ClO2S2 and a molecular weight of 242.79 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)pentanoic acid;hydrochloride.
| Compound Name | 5-(dithiolan-3-yl)pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 87930761 |
| Molecular Formula | C8H15ClO2S2 |
| Molecular Weight | 242.79 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 5-(dithiolan-3-yl)pentanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCC1CCSS1 |
| InChI | InChI=1S/C8H14O2S2.ClH/c9-8(10)4-2-1-3-7-5-6-11-12-7;/h7H,1-6H2,(H,9,10);1H |
| InChIKey | XIDCLJUPXARIOE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|