C12H25N5O2S2 — CID 23643140
3-(diaminomethylidene)-1,1-dimethylguanidine;5-[(3R)-dithiolan-3-yl]pentanoic acid (PubChem CID 23643140) has the molecular formula C12H25N5O2S2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,1-dimethylguanidine;5-[(3R)-dithiolan-3-yl]pentanoic acid.
| Compound Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;5-[(3R)-dithiolan-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 23643140 |
| Molecular Formula | C12H25N5O2S2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;5-[(3R)-dithiolan-3-yl]pentanoic acid |
| SMILES | O=C(O)CCCC[C@@H]1CCSS1.[H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C8H14O2S2.C4H11N5/c9-8(10)4-2-1-3-7-5-6-11-12-7;1-9(2)4(7)8-3(5)6/h7H,1-6H2,(H,9,10);1-2H3,(H5,5,6,7,8)/t7-;/m1./s1 |
| InChIKey | WQCCWBILCGRHMV-OGFXRTJISA-N |
| XLogP | 1.54 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|