About (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide
(Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide (PubChem CID 156540452) has the molecular formula C16H30N2O5S2
and a molecular weight of 394.56 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide |
| PubChem CID | 156540452 |
| Molecular Formula | C16H30N2O5S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide |
| SMILES | CCN(C)C.NC(=O)CCCCC1CCSS1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C8H15NOS2.C4H11N.C4H4O4/c9-8(10)4-2-1-3-7-5-6-11-12-7;1-4-5(2)3;5-3(6)1-2-4(7)8/h7H,1-6H2,(H2,9,10);4H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | AWZIWSQWJBTMHI-KSBRXOFISA-N |
| XLogP | 2.47 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide?
The IUPAC name of (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide (CID 156540452) is (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide.
What is the SMILES notation for (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide?
The canonical SMILES for (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide is CCN(C)C.NC(=O)CCCCC1CCSS1.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide?
The InChIKey is AWZIWSQWJBTMHI-KSBRXOFISA-N. The full InChI is InChI=1S/C8H15NOS2.C4H11N.C4H4O4/c9-8(10)4-2-1-3-7-5-6-11-12-7;1-4-5(2)3;5-3(6)1-2-4(7)8/h7H,1-6H2,(H2,9,10);4H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide?
(Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide has a molecular weight of 394.56 g/mol, XLogP of 2.47, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;N,N-dimethylethanamine;5-(dithiolan-3-yl)pentanamide is sourced from PubChem (CID 156540452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).