C16H28N2O3S2 — CID 55406966
ethyl 4-[5-(dithiolan-3-yl)pentanoylamino]piperidine-1-carboxylate (PubChem CID 55406966) has the molecular formula C16H28N2O3S2 and a molecular weight of 360.55 g/mol. Its IUPAC name is ethyl 4-[5-(dithiolan-3-yl)pentanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-(dithiolan-3-yl)pentanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55406966 |
| Molecular Formula | C16H28N2O3S2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | ethyl 4-[5-(dithiolan-3-yl)pentanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCCCC2CCSS2)CC1 |
| InChI | InChI=1S/C16H28N2O3S2/c1-2-21-16(20)18-10-7-13(8-11-18)17-15(19)6-4-3-5-14-9-12-22-23-14/h13-14H,2-12H2,1H3,(H,17,19) |
| InChIKey | KTFJYYIMRUWBGQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|