C21H32N4OS2 — CID 121019495
5-(dithiolan-3-yl)-N-[1-(5,6,7,8-tetrahydroquinazolin-4-yl)piperidin-4-yl]pentanamide (PubChem CID 121019495) has the molecular formula C21H32N4OS2 and a molecular weight of 420.65 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[1-(5,6,7,8-tetrahydroquinazolin-4-yl)piperidin-4-yl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[1-(5,6,7,8-tetrahydroquinazolin-4-yl)piperidin-4-yl]pentanamide |
|---|---|
| PubChem CID | 121019495 |
| Molecular Formula | C21H32N4OS2 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[1-(5,6,7,8-tetrahydroquinazolin-4-yl)piperidin-4-yl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NC1CCN(c2ncnc3c2CCCC3)CC1 |
| InChI | InChI=1S/C21H32N4OS2/c26-20(8-4-1-5-17-11-14-27-28-17)24-16-9-12-25(13-10-16)21-18-6-2-3-7-19(18)22-15-23-21/h15-17H,1-14H2,(H,24,26) |
| InChIKey | VHZCAPYHKHCWQS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|