C14H26N2O3 — CID 110756025
ethyl 4-(3,3-dimethylbutanoylamino)piperidine-1-carboxylate (PubChem CID 110756025) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is ethyl 4-(3,3-dimethylbutanoylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(3,3-dimethylbutanoylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110756025 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | ethyl 4-(3,3-dimethylbutanoylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H26N2O3/c1-5-19-13(18)16-8-6-11(7-9-16)15-12(17)10-14(2,3)4/h11H,5-10H2,1-4H3,(H,15,17) |
| InChIKey | YMDYSZCQHCVHPE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |