C20H35N3O4 — CID 109149356
ethyl 4-[[4-(tert-butylcarbamoyl)cyclohexanecarbonyl]amino]piperidine-1-carboxylate (PubChem CID 109149356) has the molecular formula C20H35N3O4 and a molecular weight of 381.52 g/mol. Its IUPAC name is ethyl 4-[[4-(tert-butylcarbamoyl)cyclohexanecarbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-(tert-butylcarbamoyl)cyclohexanecarbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109149356 |
| Molecular Formula | C20H35N3O4 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | ethyl 4-[[4-(tert-butylcarbamoyl)cyclohexanecarbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2CCC(C(=O)NC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H35N3O4/c1-5-27-19(26)23-12-10-16(11-13-23)21-17(24)14-6-8-15(9-7-14)18(25)22-20(2,3)4/h14-16H,5-13H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | DCJCYVKUTQWCKS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |