C12H20N2O4 — CID 79346721
2-hydroxyethyl 4-(cyclopropanecarbonylamino)piperidine-1-carboxylate (PubChem CID 79346721) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-hydroxyethyl 4-(cyclopropanecarbonylamino)piperidine-1-carboxylate.
| Compound Name | 2-hydroxyethyl 4-(cyclopropanecarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 79346721 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-hydroxyethyl 4-(cyclopropanecarbonylamino)piperidine-1-carboxylate |
| SMILES | O=C(NC1CCN(C(=O)OCCO)CC1)C1CC1 |
| InChI | InChI=1S/C12H20N2O4/c15-7-8-18-12(17)14-5-3-10(4-6-14)13-11(16)9-1-2-9/h9-10,15H,1-8H2,(H,13,16) |
| InChIKey | MMIOAFGXKQCXOI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |