C8H15KO2S2 — CID 174478927
potassium;5-(dithiolan-3-yl)pentanoic acid;hydride (PubChem CID 174478927) has the molecular formula C8H15KO2S2 and a molecular weight of 246.44 g/mol. Its IUPAC name is potassium;5-(dithiolan-3-yl)pentanoic acid;hydride.
| Compound Name | potassium;5-(dithiolan-3-yl)pentanoic acid;hydride |
|---|---|
| PubChem CID | 174478927 |
| Molecular Formula | C8H15KO2S2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | potassium;5-(dithiolan-3-yl)pentanoic acid;hydride |
| SMILES | O=C(O)CCCCC1CCSS1.[H-].[K+] |
| InChI | InChI=1S/C8H14O2S2.K.H/c9-8(10)4-2-1-3-7-5-6-11-12-7;;/h7H,1-6H2,(H,9,10);;/q;+1;-1 |
| InChIKey | IGLMMSBDWRHKRR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|