C11H24N4O2S2 — CID 175206792
2-(2-aminoethyl)guanidine;5-[(3R)-dithiolan-3-yl]pentanoic acid (PubChem CID 175206792) has the molecular formula C11H24N4O2S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-(2-aminoethyl)guanidine;5-[(3R)-dithiolan-3-yl]pentanoic acid.
| Compound Name | 2-(2-aminoethyl)guanidine;5-[(3R)-dithiolan-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 175206792 |
| Molecular Formula | C11H24N4O2S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-(2-aminoethyl)guanidine;5-[(3R)-dithiolan-3-yl]pentanoic acid |
| SMILES | NCCN=C(N)N.O=C(O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C8H14O2S2.C3H10N4/c9-8(10)4-2-1-3-7-5-6-11-12-7;4-1-2-7-3(5)6/h7H,1-6H2,(H,9,10);1-2,4H2,(H4,5,6,7)/t7-;/m1./s1 |
| InChIKey | HLNRCSQQDGXTJL-OGFXRTJISA-N |
| XLogP | 1.00 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|