C20H31NO6S4 — CID 160993405
(2,5-dioxopyrrolidin-1-yl) 5-[(3R)-dithiolan-3-yl]pentanoate;5-[(3R)-dithiolan-3-yl]pentanoic acid (PubChem CID 160993405) has the molecular formula C20H31NO6S4 and a molecular weight of 509.74 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-[(3R)-dithiolan-3-yl]pentanoate;5-[(3R)-dithiolan-3-yl]pentanoic acid.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-[(3R)-dithiolan-3-yl]pentanoate;5-[(3R)-dithiolan-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 160993405 |
| Molecular Formula | C20H31NO6S4 |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[(3R)-dithiolan-3-yl]pentanoate;5-[(3R)-dithiolan-3-yl]pentanoic acid |
| SMILES | O=C(CCCC[C@@H]1CCSS1)ON1C(=O)CCC1=O.O=C(O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C12H17NO4S2.C8H14O2S2/c14-10-5-6-11(15)13(10)17-12(16)4-2-1-3-9-7-8-18-19-9;9-8(10)4-2-1-3-7-5-6-11-12-7/h9H,1-8H2;7H,1-6H2,(H,9,10)/t9-;7-/m11/s1 |
| InChIKey | TUXUCTBDVZJROQ-XPNWLKPYSA-N |
| XLogP | 5.09 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|