C14H13F5O2S2 — CID 59617501
(2,3,4,5,6-pentafluorophenyl) 5-[(3R)-dithiolan-3-yl]pentanoate (PubChem CID 59617501) has the molecular formula C14H13F5O2S2 and a molecular weight of 372.38 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-[(3R)-dithiolan-3-yl]pentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-[(3R)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 59617501 |
| Molecular Formula | C14H13F5O2S2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-[(3R)-dithiolan-3-yl]pentanoate |
| SMILES | O=C(CCCC[C@@H]1CCSS1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H13F5O2S2/c15-9-10(16)12(18)14(13(19)11(9)17)21-8(20)4-2-1-3-7-5-6-22-23-7/h7H,1-6H2/t7-/m1/s1 |
| InChIKey | LDPFPZDAYYNYIO-SSDOTTSWSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|