C23H36N6O3S2 — CID 11598661
(2S)-5-(diaminomethylideneamino)-2-[[(2R)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-3-phenylpropanoyl]amino]pentanamide (PubChem CID 11598661) has the molecular formula C23H36N6O3S2 and a molecular weight of 508.71 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2R)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-3-phenylpropanoyl]amino]pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2R)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-3-phenylpropanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 11598661 |
| Molecular Formula | C23H36N6O3S2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2R)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-3-phenylpropanoyl]amino]pentanamide |
| SMILES | NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](Cc1ccccc1)NC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C23H36N6O3S2/c24-21(31)18(10-6-13-27-23(25)26)29-22(32)19(15-16-7-2-1-3-8-16)28-20(30)11-5-4-9-17-12-14-33-34-17/h1-3,7-8,17-19H,4-6,9-15H2,(H2,24,31)(H,28,30)(H,29,32)(H4,25,26,27)/t17-,18+,19-/m1/s1 |
| InChIKey | OLHMLELAENTRGB-CEXWTWQISA-N |
| XLogP | 1.45 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|