C25H38N6O2 — CID 10279384
2-(1-adamantylamino)-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(diaminomethylideneamino)pentanamide (PubChem CID 10279384) has the molecular formula C25H38N6O2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 2-(1-adamantylamino)-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(diaminomethylideneamino)pentanamide.
| Compound Name | 2-(1-adamantylamino)-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 10279384 |
| Molecular Formula | C25H38N6O2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 2-(1-adamantylamino)-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)C(CCCN=C(N)N)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H38N6O2/c26-22(32)21(12-16-5-2-1-3-6-16)30-23(33)20(7-4-8-29-24(27)28)31-25-13-17-9-18(14-25)11-19(10-17)15-25/h1-3,5-6,17-21,31H,4,7-15H2,(H2,26,32)(H,30,33)(H4,27,28,29) |
| InChIKey | VGVOJTSJBOZNCN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|