C17H26N6O3S — CID 46882491
(2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(2-sulfanylacetyl)amino]pentanamide (PubChem CID 46882491) has the molecular formula C17H26N6O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(2-sulfanylacetyl)amino]pentanamide.
| Compound Name | (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(2-sulfanylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 46882491 |
| Molecular Formula | C17H26N6O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(2-sulfanylacetyl)amino]pentanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CS |
| InChI | InChI=1S/C17H26N6O3S/c18-15(25)13(9-11-5-2-1-3-6-11)23-16(26)12(22-14(24)10-27)7-4-8-21-17(19)20/h1-3,5-6,12-13,27H,4,7-10H2,(H2,18,25)(H,22,24)(H,23,26)(H4,19,20,21)/t12-,13-/m0/s1 |
| InChIKey | ZZSJCRUAQOHMRI-STQMWFEESA-N |
| XLogP | -1.33 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|