C29H49N9O4 — CID 154941245
6-amino-2-[[2-[[2-[(2-amino-3-cyclopentylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]hexanamide (PubChem CID 154941245) has the molecular formula C29H49N9O4 and a molecular weight of 587.77 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-cyclopentylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]hexanamide.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-cyclopentylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 154941245 |
| Molecular Formula | C29H49N9O4 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.39 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-cyclopentylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
| SMILES | NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC1CCCC1)C(N)=O |
| InChI | InChI=1S/C29H49N9O4/c30-15-7-6-13-22(25(32)39)36-28(42)24(18-20-9-2-1-3-10-20)38-27(41)23(14-8-16-35-29(33)34)37-26(40)21(31)17-19-11-4-5-12-19/h1-3,9-10,19,21-24H,4-8,11-18,30-31H2,(H2,32,39)(H,36,42)(H,37,40)(H,38,41)(H4,33,34,35) |
| InChIKey | WSKCAPUSSXFRHO-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 246.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|