C10H21N5O4 — CID 176517740
2-carbamimidoyl-1,1-dimethylguanidine;hexanedioic acid (PubChem CID 176517740) has the molecular formula C10H21N5O4 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dimethylguanidine;hexanedioic acid.
| Compound Name | 2-carbamimidoyl-1,1-dimethylguanidine;hexanedioic acid |
|---|---|
| PubChem CID | 176517740 |
| Molecular Formula | C10H21N5O4 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-carbamimidoyl-1,1-dimethylguanidine;hexanedioic acid |
| SMILES | O=C(O)CCCCC(=O)O.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C6H10O4.C4H11N5/c7-5(8)3-1-2-4-6(9)10;1-9(2)4(7)8-3(5)6/h1-4H2,(H,7,8)(H,9,10);1-2H3,(H5,5,6,7,8) |
| InChIKey | FZRPJHSCRAZBPK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 166.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|